C20H24N2O7S — CID 17310311
2-(1,3-benzodioxol-5-yloxy)-N-[4-(3-ethoxypropylsulfamoyl)phenyl]acetamide (PubChem CID 17310311) has the molecular formula C20H24N2O7S and a molecular weight of 436.49 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-N-[4-(3-ethoxypropylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-N-[4-(3-ethoxypropylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 17310311 |
| Molecular Formula | C20H24N2O7S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-N-[4-(3-ethoxypropylsulfamoyl)phenyl]acetamide |
| SMILES | CCOCCCNS(=O)(=O)c1ccc(NC(=O)COc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C20H24N2O7S/c1-2-26-11-3-10-21-30(24,25)17-7-4-15(5-8-17)22-20(23)13-27-16-6-9-18-19(12-16)29-14-28-18/h4-9,12,21H,2-3,10-11,13-14H2,1H3,(H,22,23) |
| InChIKey | LJDOWXFCQPUPDW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|