C9H5BrCl2FN5 — CID 172979841
(1Z)-2-amino-N-(6-bromo-2,4-dichloro-3-fluoroanilino)-2-iminoethanimidoyl cyanide (PubChem CID 172979841) has the molecular formula C9H5BrCl2FN5 and a molecular weight of 352.98 g/mol. Its IUPAC name is (1Z)-2-amino-N-(6-bromo-2,4-dichloro-3-fluoroanilino)-2-iminoethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-N-(6-bromo-2,4-dichloro-3-fluoroanilino)-2-iminoethanimidoyl cyanide |
|---|---|
| PubChem CID | 172979841 |
| Molecular Formula | C9H5BrCl2FN5 |
| Molecular Weight | 352.98 g/mol |
| Exact Mass | 350.91 |
| IUPAC Name | (1Z)-2-amino-N-(6-bromo-2,4-dichloro-3-fluoroanilino)-2-iminoethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1c(Br)cc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C9H5BrCl2FN5/c10-3-1-4(11)7(13)6(12)8(3)18-17-5(2-14)9(15)16/h1,18H,(H3,15,16)/b17-5+ |
| InChIKey | ZWHSKNNJQMGLGI-YAXRCOADSA-N |
| XLogP | 3.12 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.98 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|