C11H11N9O — CID 172978506
(1Z)-2-amino-2-imino-N-[3-methoxy-4-(tetrazol-1-yl)anilino]ethanimidoyl cyanide (PubChem CID 172978506) has the molecular formula C11H11N9O and a molecular weight of 285.27 g/mol. Its IUPAC name is (1Z)-2-amino-2-imino-N-[3-methoxy-4-(tetrazol-1-yl)anilino]ethanimidoyl cyanide.
| Compound Name | (1Z)-2-amino-2-imino-N-[3-methoxy-4-(tetrazol-1-yl)anilino]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 172978506 |
| Molecular Formula | C11H11N9O |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (1Z)-2-amino-2-imino-N-[3-methoxy-4-(tetrazol-1-yl)anilino]ethanimidoyl cyanide |
| SMILES | [H]/N=C(N)/C(C#N)=N/Nc1ccc(-n2cnnn2)c(OC)c1 |
| InChI | InChI=1S/C11H11N9O/c1-21-10-4-7(16-17-8(5-12)11(13)14)2-3-9(10)20-6-15-18-19-20/h2-4,6,16H,1H3,(H3,13,14)/b17-8+ |
| InChIKey | MEQIAGWNJQXDQU-CAOOACKPSA-N |
| XLogP | -0.10 |
| TPSA | 150.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|