C19H13F6N7O2 — CID 169346713
3-[5-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346713) has the molecular formula C19H13F6N7O2 and a molecular weight of 485.35 g/mol. Its IUPAC name is 3-[5-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[5-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346713 |
| Molecular Formula | C19H13F6N7O2 |
| Molecular Weight | 485.35 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 3-[5-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyanilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cc(C(c2ccc(O)c(N)c2)(C(F)(F)F)C(F)(F)F)ccc1O)c1nn[nH]n1 |
| InChI | InChI=1S/C19H13F6N7O2/c20-18(21,22)17(19(23,24)25,10-1-3-14(33)12(27)5-10)11-2-4-15(34)13(6-11)28-8-9(7-26)16-29-31-32-30-16/h1-6,8,28,33-34H,27H2,(H,29,30,31,32) |
| InChIKey | KKKVOMAGGMKKRA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 156.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|