C41H31F12N4O4 — CID 58696740
CID 58696740 (PubChem CID 58696740) has the molecular formula C41H31F12N4O4 and a molecular weight of 871.70 g/mol.
| Compound Name | CID 58696740 |
|---|---|
| PubChem CID | 58696740 |
| Molecular Formula | C41H31F12N4O4 |
| Molecular Weight | 871.70 g/mol |
| Exact Mass | 871.22 |
| IUPAC Name | — |
| SMILES | CNc1cc(C(c2ccc(O)c(NC(=O)c3cccc(C(=O)Nc4cc(C(c5ccc(O)c([NH])c5)(C(F)(F)F)C(F)(F)F)ccc4C)c3)c2)(C(F)(F)F)C(F)(F)F)ccc1C |
| InChI | InChI=1S/C41H31F12N4O4/c1-20-7-9-25(17-29(20)55-3)37(40(48,49)50,41(51,52)53)27-12-14-33(59)31(19-27)57-35(61)23-6-4-5-22(15-23)34(60)56-30-18-26(10-8-21(30)2)36(38(42,43)44,39(45,46)47)24-11-13-32(58)28(54)16-24/h4-19,54-55,58-59H,1-3H3,(H,56,60)(H,57,61) |
| InChIKey | ISNQKMXPUBRMLL-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 134.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.70 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|