C33H24F6N2O9 — CID 59346238
5-[3-carboxy-4-[[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]carbamoyl]phenoxy]-2-(methylcarbamoyl)benzoic acid (PubChem CID 59346238) has the molecular formula C33H24F6N2O9 and a molecular weight of 706.55 g/mol. Its IUPAC name is 5-[3-carboxy-4-[[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]carbamoyl]phenoxy]-2-(methylcarbamoyl)benzoic acid.
| Compound Name | 5-[3-carboxy-4-[[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]carbamoyl]phenoxy]-2-(methylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 59346238 |
| Molecular Formula | C33H24F6N2O9 |
| Molecular Weight | 706.55 g/mol |
| Exact Mass | 706.14 |
| IUPAC Name | 5-[3-carboxy-4-[[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]carbamoyl]phenoxy]-2-(methylcarbamoyl)benzoic acid |
| SMILES | CNC(=O)c1ccc(Oc2ccc(C(=O)Nc3cc(C(c4ccc(O)c(C)c4)(C(F)(F)F)C(F)(F)F)ccc3O)c(C(=O)O)c2)cc1C(=O)O |
| InChI | InChI=1S/C33H24F6N2O9/c1-15-11-16(3-9-25(15)42)31(32(34,35)36,33(37,38)39)17-4-10-26(43)24(12-17)41-28(45)21-8-6-19(14-23(21)30(48)49)50-18-5-7-20(27(44)40-2)22(13-18)29(46)47/h3-14,42-43H,1-2H3,(H,40,44)(H,41,45)(H,46,47)(H,48,49) |
| InChIKey | QBVBGYALYJJCJM-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 182.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.55 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|