C35H28F6N2O8 — CID 139492440
methyl 5-[4-[[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]carbamoyl]-3-methoxycarbonylphenyl]-2-(methylcarbamoyl)benzoate (PubChem CID 139492440) has the molecular formula C35H28F6N2O8 and a molecular weight of 718.60 g/mol. Its IUPAC name is methyl 5-[4-[[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]carbamoyl]-3-methoxycarbonylphenyl]-2-(methylcarbamoyl)benzoate.
| Compound Name | methyl 5-[4-[[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]carbamoyl]-3-methoxycarbonylphenyl]-2-(methylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 139492440 |
| Molecular Formula | C35H28F6N2O8 |
| Molecular Weight | 718.60 g/mol |
| Exact Mass | 718.17 |
| IUPAC Name | methyl 5-[4-[[5-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-hydroxyphenyl]carbamoyl]-3-methoxycarbonylphenyl]-2-(methylcarbamoyl)benzoate |
| SMILES | CNC(=O)c1ccc(-c2ccc(C(=O)Nc3cc(C(c4ccc(O)c(C)c4)(C(F)(F)F)C(F)(F)F)ccc3O)c(C(=O)OC)c2)cc1C(=O)OC |
| InChI | InChI=1S/C35H28F6N2O8/c1-17-13-20(7-11-27(17)44)33(34(36,37)38,35(39,40)41)21-8-12-28(45)26(16-21)43-30(47)23-10-6-19(15-25(23)32(49)51-4)18-5-9-22(29(46)42-2)24(14-18)31(48)50-3/h5-16,44-45H,1-4H3,(H,42,46)(H,43,47) |
| InChIKey | KANOTAFIZJUNJX-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.60 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|