C29H20F6N2O4 — CID 87103449
5-[4-[2-[4-(3-carbamoyl-4-hydroxyphenyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2-hydroxybenzamide (PubChem CID 87103449) has the molecular formula C29H20F6N2O4 and a molecular weight of 574.48 g/mol. Its IUPAC name is 5-[4-[2-[4-(3-carbamoyl-4-hydroxyphenyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2-hydroxybenzamide.
| Compound Name | 5-[4-[2-[4-(3-carbamoyl-4-hydroxyphenyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 87103449 |
| Molecular Formula | C29H20F6N2O4 |
| Molecular Weight | 574.48 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | 5-[4-[2-[4-(3-carbamoyl-4-hydroxyphenyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-2-hydroxybenzamide |
| SMILES | NC(=O)c1cc(-c2ccc(C(c3ccc(-c4ccc(O)c(C(N)=O)c4)cc3)(C(F)(F)F)C(F)(F)F)cc2)ccc1O |
| InChI | InChI=1S/C29H20F6N2O4/c30-28(31,32)27(29(33,34)35,19-7-1-15(2-8-19)17-5-11-23(38)21(13-17)25(36)40)20-9-3-16(4-10-20)18-6-12-24(39)22(14-18)26(37)41/h1-14,38-39H,(H2,36,40)(H2,37,41) |
| InChIKey | LBZJGGQFJFHHJJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.48 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |