About CID 174726274
CID 174726274 (PubChem CID 174726274) has the molecular formula C7H6NO2Se
and a molecular weight of 215.09 g/mol.
Molecular Properties
| Compound Name | CID 174726274 |
| PubChem CID | 174726274 |
| Molecular Formula | C7H6NO2Se |
| Molecular Weight | 215.09 g/mol |
| Exact Mass | 215.96 |
| IUPAC Name | — |
| SMILES | NC(=O)c1cc([Se])ccc1O |
| InChI | InChI=1S/C7H6NO2Se/c8-7(10)5-3-4(11)1-2-6(5)9/h1-3,9H,(H2,8,10) |
| InChIKey | YVPCFDHPDBNMTP-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.09 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174726274 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174726274?
The IUPAC name of CID 174726274 (CID 174726274) is not available.
What is the SMILES notation for CID 174726274?
The canonical SMILES for CID 174726274 is NC(=O)c1cc([Se])ccc1O.
What is the InChIKey of CID 174726274?
The InChIKey is YVPCFDHPDBNMTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6NO2Se/c8-7(10)5-3-4(11)1-2-6(5)9/h1-3,9H,(H2,8,10).
What are the key properties of CID 174726274?
CID 174726274 has a molecular weight of 215.09 g/mol, XLogP of -0.72, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174726274 is sourced from PubChem (CID 174726274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).