C7H9N3O2 — CID 70024037
2,3-diamino-4-hydroxybenzamide (PubChem CID 70024037) has the molecular formula C7H9N3O2 and a molecular weight of 167.17 g/mol. Its IUPAC name is 2,3-diamino-4-hydroxybenzamide.
| Compound Name | 2,3-diamino-4-hydroxybenzamide |
|---|---|
| PubChem CID | 70024037 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 2,3-diamino-4-hydroxybenzamide |
| SMILES | NC(=O)c1ccc(O)c(N)c1N |
| InChI | InChI=1S/C7H9N3O2/c8-5-3(7(10)12)1-2-4(11)6(5)9/h1-2,11H,8-9H2,(H2,10,12) |
| InChIKey | FIVCPCQGEALBNC-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|