C9H12N2O4 — CID 141050077
1-(2,3-diamino-4-hydroxyphenyl)-2,3-dihydroxypropan-1-one (PubChem CID 141050077) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is 1-(2,3-diamino-4-hydroxyphenyl)-2,3-dihydroxypropan-1-one.
| Compound Name | 1-(2,3-diamino-4-hydroxyphenyl)-2,3-dihydroxypropan-1-one |
|---|---|
| PubChem CID | 141050077 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 1-(2,3-diamino-4-hydroxyphenyl)-2,3-dihydroxypropan-1-one |
| SMILES | Nc1c(O)ccc(C(=O)C(O)CO)c1N |
| InChI | InChI=1S/C9H12N2O4/c10-7-4(9(15)6(14)3-12)1-2-5(13)8(7)11/h1-2,6,12-14H,3,10-11H2 |
| InChIKey | HPMSPBRRUJMBMX-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|