C9H12O5 — CID 140998893
2,3-dihydroxy-1-(2-hydroxyphenyl)propan-1-one;hydrate (PubChem CID 140998893) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is 2,3-dihydroxy-1-(2-hydroxyphenyl)propan-1-one;hydrate.
| Compound Name | 2,3-dihydroxy-1-(2-hydroxyphenyl)propan-1-one;hydrate |
|---|---|
| PubChem CID | 140998893 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2,3-dihydroxy-1-(2-hydroxyphenyl)propan-1-one;hydrate |
| SMILES | O.O=C(c1ccccc1O)C(O)CO |
| InChI | InChI=1S/C9H10O4.H2O/c10-5-8(12)9(13)6-3-1-2-4-7(6)11;/h1-4,8,10-12H,5H2;1H2 |
| InChIKey | FPYRJOCOHQMYME-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 109.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |