C9H14N2O4 — CID 141095298
1-(2,6-diaminophenyl)-2,3-dihydroxypropan-1-one;hydrate (PubChem CID 141095298) has the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. Its IUPAC name is 1-(2,6-diaminophenyl)-2,3-dihydroxypropan-1-one;hydrate.
| Compound Name | 1-(2,6-diaminophenyl)-2,3-dihydroxypropan-1-one;hydrate |
|---|---|
| PubChem CID | 141095298 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 1-(2,6-diaminophenyl)-2,3-dihydroxypropan-1-one;hydrate |
| SMILES | Nc1cccc(N)c1C(=O)C(O)CO.O |
| InChI | InChI=1S/C9H12N2O3.H2O/c10-5-2-1-3-6(11)8(5)9(14)7(13)4-12;/h1-3,7,12-13H,4,10-11H2;1H2 |
| InChIKey | FQINYLPLPJHGIZ-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 141.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|