C14H12O4 — CID 15792827
2-hydroxy-1,2-bis(2-hydroxyphenyl)ethanone (PubChem CID 15792827) has the molecular formula C14H12O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is 2-hydroxy-1,2-bis(2-hydroxyphenyl)ethanone.
| Compound Name | 2-hydroxy-1,2-bis(2-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 15792827 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-hydroxy-1,2-bis(2-hydroxyphenyl)ethanone |
| SMILES | O=C(c1ccccc1O)C(O)c1ccccc1O |
| InChI | InChI=1S/C14H12O4/c15-11-7-3-1-5-9(11)13(17)14(18)10-6-2-4-8-12(10)16/h1-8,13,15-17H |
| InChIKey | PNGGEPPGOAAOCM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |