potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid

C8H9KO4 — CID 173256865

IUPACpotassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid
SMILESO=C(O)[C@H](O)c1ccccc1O.[H-].[K+]
InChIInChI=1S/C8H8O4.K.H/c9-6-4-2-1-3-5(6)7(10)8(11)12;;/h1-4,7,9-10H,(H,11,12);;/q;+1;-1/t7-;;/m1../s1
InChIKeyPKCONTNURSLTRM-XCUBXKJBSA-N
MW208.25 g/mol
LogP-2.37
Rot. Bonds2

About potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid

potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid (PubChem CID 173256865) has the molecular formula C8H9KO4 and a molecular weight of 208.25 g/mol. Its IUPAC name is potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid.

Molecular Properties

Compound Namepotassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid
PubChem CID173256865
Molecular FormulaC8H9KO4
Molecular Weight208.25 g/mol
Exact Mass208.01
IUPAC Namepotassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid
SMILESO=C(O)[C@H](O)c1ccccc1O.[H-].[K+]
InChIInChI=1S/C8H8O4.K.H/c9-6-4-2-1-3-5(6)7(10)8(11)12;;/h1-4,7,9-10H,(H,11,12);;/q;+1;-1/t7-;;/m1../s1
InChIKeyPKCONTNURSLTRM-XCUBXKJBSA-N
XLogP-2.37
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.25
LogP ≤ 5-2.37
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid?
The IUPAC name of potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid (CID 173256865) is potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid.
What is the SMILES notation for potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid?
The canonical SMILES for potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid is O=C(O)[C@H](O)c1ccccc1O.[H-].[K+].
What is the InChIKey of potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid?
The InChIKey is PKCONTNURSLTRM-XCUBXKJBSA-N. The full InChI is InChI=1S/C8H8O4.K.H/c9-6-4-2-1-3-5(6)7(10)8(11)12;;/h1-4,7,9-10H,(H,11,12);;/q;+1;-1/t7-;;/m1../s1.
What are the key properties of potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid?
potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid has a molecular weight of 208.25 g/mol, XLogP of -2.37, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid is sourced from PubChem (CID 173256865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).