About potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid
potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid (PubChem CID 173256865) has the molecular formula C8H9KO4
and a molecular weight of 208.25 g/mol. Its IUPAC name is potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid.
Molecular Properties
| Compound Name | potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid |
| PubChem CID | 173256865 |
| Molecular Formula | C8H9KO4 |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid |
| SMILES | O=C(O)[C@H](O)c1ccccc1O.[H-].[K+] |
| InChI | InChI=1S/C8H8O4.K.H/c9-6-4-2-1-3-5(6)7(10)8(11)12;;/h1-4,7,9-10H,(H,11,12);;/q;+1;-1/t7-;;/m1../s1 |
| InChIKey | PKCONTNURSLTRM-XCUBXKJBSA-N |
| XLogP | -2.37 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid?
The IUPAC name of potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid (CID 173256865) is potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid.
What is the SMILES notation for potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid?
The canonical SMILES for potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid is O=C(O)[C@H](O)c1ccccc1O.[H-].[K+].
What is the InChIKey of potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid?
The InChIKey is PKCONTNURSLTRM-XCUBXKJBSA-N. The full InChI is InChI=1S/C8H8O4.K.H/c9-6-4-2-1-3-5(6)7(10)8(11)12;;/h1-4,7,9-10H,(H,11,12);;/q;+1;-1/t7-;;/m1../s1.
What are the key properties of potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid?
potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid has a molecular weight of 208.25 g/mol, XLogP of -2.37, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;(2R)-2-hydroxy-2-(2-hydroxyphenyl)acetic acid is sourced from PubChem (CID 173256865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).