C8H8NaO4 — CID 70117604
CID 70117604 (PubChem CID 70117604) has the molecular formula C8H8NaO4 and a molecular weight of 191.14 g/mol.
| Compound Name | CID 70117604 |
|---|---|
| PubChem CID | 70117604 |
| Molecular Formula | C8H8NaO4 |
| Molecular Weight | 191.14 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | — |
| SMILES | O=C(O)C(O)c1ccccc1O.[Na] |
| InChI | InChI=1S/C8H8O4.Na/c9-6-4-2-1-3-5(6)7(10)8(11)12;/h1-4,7,9-10H,(H,11,12); |
| InChIKey | JDSOSUKUNGDHLU-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.14 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |