C14H10F3NO4 — CID 118180284
N,2-dihydroxy-5-[4-(trifluoromethoxy)phenyl]benzamide (PubChem CID 118180284) has the molecular formula C14H10F3NO4 and a molecular weight of 313.23 g/mol. Its IUPAC name is N,2-dihydroxy-5-[4-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | N,2-dihydroxy-5-[4-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 118180284 |
| Molecular Formula | C14H10F3NO4 |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | N,2-dihydroxy-5-[4-(trifluoromethoxy)phenyl]benzamide |
| SMILES | O=C(NO)c1cc(-c2ccc(OC(F)(F)F)cc2)ccc1O |
| InChI | InChI=1S/C14H10F3NO4/c15-14(16,17)22-10-4-1-8(2-5-10)9-3-6-12(19)11(7-9)13(20)18-21/h1-7,19,21H,(H,18,20) |
| InChIKey | QCLIDBFPPRIQKI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|