C37H28F6N2O7S — CID 59749952
4-(4-acetylphenoxy)-N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-[(4-methylphenyl)sulfonylamino]phenyl]propan-2-yl]-2-hydroxyphenyl]benzamide (PubChem CID 59749952) has the molecular formula C37H28F6N2O7S and a molecular weight of 758.69 g/mol. Its IUPAC name is 4-(4-acetylphenoxy)-N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-[(4-methylphenyl)sulfonylamino]phenyl]propan-2-yl]-2-hydroxyphenyl]benzamide.
| Compound Name | 4-(4-acetylphenoxy)-N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-[(4-methylphenyl)sulfonylamino]phenyl]propan-2-yl]-2-hydroxyphenyl]benzamide |
|---|---|
| PubChem CID | 59749952 |
| Molecular Formula | C37H28F6N2O7S |
| Molecular Weight | 758.69 g/mol |
| Exact Mass | 758.15 |
| IUPAC Name | 4-(4-acetylphenoxy)-N-[5-[1,1,1,3,3,3-hexafluoro-2-[4-hydroxy-3-[(4-methylphenyl)sulfonylamino]phenyl]propan-2-yl]-2-hydroxyphenyl]benzamide |
| SMILES | CC(=O)c1ccc(Oc2ccc(C(=O)Nc3cc(C(c4ccc(O)c(NS(=O)(=O)c5ccc(C)cc5)c4)(C(F)(F)F)C(F)(F)F)ccc3O)cc2)cc1 |
| InChI | InChI=1S/C37H28F6N2O7S/c1-21-3-15-29(16-4-21)53(50,51)45-31-20-26(10-18-33(31)48)35(36(38,39)40,37(41,42)43)25-9-17-32(47)30(19-25)44-34(49)24-7-13-28(14-8-24)52-27-11-5-23(6-12-27)22(2)46/h3-20,45,47-48H,1-2H3,(H,44,49) |
| InChIKey | AZWNWTVOEXIETC-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.69 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|