C30H24F3IN2O4 — CID 162548179
N-(2-hydroxy-5-methylphenyl)-4-[2,2,2-trifluoro-1-[4-[(2-hydroxy-5-methylphenyl)carbamoyl]phenyl]-1-iodoethyl]benzamide (PubChem CID 162548179) has the molecular formula C30H24F3IN2O4 and a molecular weight of 660.43 g/mol. Its IUPAC name is N-(2-hydroxy-5-methylphenyl)-4-[2,2,2-trifluoro-1-[4-[(2-hydroxy-5-methylphenyl)carbamoyl]phenyl]-1-iodoethyl]benzamide.
| Compound Name | N-(2-hydroxy-5-methylphenyl)-4-[2,2,2-trifluoro-1-[4-[(2-hydroxy-5-methylphenyl)carbamoyl]phenyl]-1-iodoethyl]benzamide |
|---|---|
| PubChem CID | 162548179 |
| Molecular Formula | C30H24F3IN2O4 |
| Molecular Weight | 660.43 g/mol |
| Exact Mass | 660.07 |
| IUPAC Name | N-(2-hydroxy-5-methylphenyl)-4-[2,2,2-trifluoro-1-[4-[(2-hydroxy-5-methylphenyl)carbamoyl]phenyl]-1-iodoethyl]benzamide |
| SMILES | Cc1ccc(O)c(NC(=O)c2ccc(C(I)(c3ccc(C(=O)Nc4cc(C)ccc4O)cc3)C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C30H24F3IN2O4/c1-17-3-13-25(37)23(15-17)35-27(39)19-5-9-21(10-6-19)29(34,30(31,32)33)22-11-7-20(8-12-22)28(40)36-24-16-18(2)4-14-26(24)38/h3-16,37-38H,1-2H3,(H,35,39)(H,36,40) |
| InChIKey | APNBFYMUSQSPDN-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.43 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|