C18H19NO3 — CID 17123767
N-(2-hydroxy-5-methylphenyl)-4-(2-methylprop-2-enoxy)benzamide (PubChem CID 17123767) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is N-(2-hydroxy-5-methylphenyl)-4-(2-methylprop-2-enoxy)benzamide.
| Compound Name | N-(2-hydroxy-5-methylphenyl)-4-(2-methylprop-2-enoxy)benzamide |
|---|---|
| PubChem CID | 17123767 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | N-(2-hydroxy-5-methylphenyl)-4-(2-methylprop-2-enoxy)benzamide |
| SMILES | C=C(C)COc1ccc(C(=O)Nc2cc(C)ccc2O)cc1 |
| InChI | InChI=1S/C18H19NO3/c1-12(2)11-22-15-7-5-14(6-8-15)18(21)19-16-10-13(3)4-9-17(16)20/h4-10,20H,1,11H2,2-3H3,(H,19,21) |
| InChIKey | QYDVCKWHTSUWAI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|