C15H16N2O2 — CID 104757000
N-(5-amino-2,4-dimethylphenyl)-4-hydroxybenzamide (PubChem CID 104757000) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is N-(5-amino-2,4-dimethylphenyl)-4-hydroxybenzamide.
| Compound Name | N-(5-amino-2,4-dimethylphenyl)-4-hydroxybenzamide |
|---|---|
| PubChem CID | 104757000 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N-(5-amino-2,4-dimethylphenyl)-4-hydroxybenzamide |
| SMILES | Cc1cc(C)c(NC(=O)c2ccc(O)cc2)cc1N |
| InChI | InChI=1S/C15H16N2O2/c1-9-7-10(2)14(8-13(9)16)17-15(19)11-3-5-12(18)6-4-11/h3-8,18H,16H2,1-2H3,(H,17,19) |
| InChIKey | DLOMWRAEYAOUCM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|