C42H44N2O4 — CID 70523417
1-N,4-N-bis[4-[2-(4-hydroxyphenyl)propan-2-yl]-2,5-dimethylphenyl]benzene-1,4-dicarboxamide (PubChem CID 70523417) has the molecular formula C42H44N2O4 and a molecular weight of 640.82 g/mol. Its IUPAC name is 1-N,4-N-bis[4-[2-(4-hydroxyphenyl)propan-2-yl]-2,5-dimethylphenyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[4-[2-(4-hydroxyphenyl)propan-2-yl]-2,5-dimethylphenyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 70523417 |
| Molecular Formula | C42H44N2O4 |
| Molecular Weight | 640.82 g/mol |
| Exact Mass | 640.33 |
| IUPAC Name | 1-N,4-N-bis[4-[2-(4-hydroxyphenyl)propan-2-yl]-2,5-dimethylphenyl]benzene-1,4-dicarboxamide |
| SMILES | Cc1cc(C(C)(C)c2ccc(O)cc2)c(C)cc1NC(=O)c1ccc(C(=O)Nc2cc(C)c(C(C)(C)c3ccc(O)cc3)cc2C)cc1 |
| InChI | InChI=1S/C42H44N2O4/c1-25-23-37(27(3)21-35(25)41(5,6)31-13-17-33(45)18-14-31)43-39(47)29-9-11-30(12-10-29)40(48)44-38-24-26(2)36(22-28(38)4)42(7,8)32-15-19-34(46)20-16-32/h9-24,45-46H,1-8H3,(H,43,47)(H,44,48) |
| InChIKey | UOIGFJOQZCYSFH-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.82 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |