C11H8Cl2N2O3 — CID 17095605
4-chloro-N-(5-chloro-2-hydroxyphenyl)-3-methyl-1,2-oxazole-5-carboxamide (PubChem CID 17095605) has the molecular formula C11H8Cl2N2O3 and a molecular weight of 287.10 g/mol. Its IUPAC name is 4-chloro-N-(5-chloro-2-hydroxyphenyl)-3-methyl-1,2-oxazole-5-carboxamide.
| Compound Name | 4-chloro-N-(5-chloro-2-hydroxyphenyl)-3-methyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 17095605 |
| Molecular Formula | C11H8Cl2N2O3 |
| Molecular Weight | 287.10 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | 4-chloro-N-(5-chloro-2-hydroxyphenyl)-3-methyl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1noc(C(=O)Nc2cc(Cl)ccc2O)c1Cl |
| InChI | InChI=1S/C11H8Cl2N2O3/c1-5-9(13)10(18-15-5)11(17)14-7-4-6(12)2-3-8(7)16/h2-4,16H,1H3,(H,14,17) |
| InChIKey | ZNCCHBGITUKHCJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.10 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|