C15H11ClN2O2S2 — CID 56581492
N-(5-chloro-2-hydroxyphenyl)-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxamide (PubChem CID 56581492) has the molecular formula C15H11ClN2O2S2 and a molecular weight of 350.85 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 56581492 |
| Molecular Formula | C15H11ClN2O2S2 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccsc2)sc1C(=O)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C15H11ClN2O2S2/c1-8-13(22-15(17-8)9-4-5-21-7-9)14(20)18-11-6-10(16)2-3-12(11)19/h2-7,19H,1H3,(H,18,20) |
| InChIKey | GPNDKVDMYGJKCJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|