C10H8Cl2N4O — CID 55178983
4-amino-N-(2,5-dichlorophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 55178983) has the molecular formula C10H8Cl2N4O and a molecular weight of 271.11 g/mol. Its IUPAC name is 4-amino-N-(2,5-dichlorophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 4-amino-N-(2,5-dichlorophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 55178983 |
| Molecular Formula | C10H8Cl2N4O |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 4-amino-N-(2,5-dichlorophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | Nc1cn[nH]c1C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H8Cl2N4O/c11-5-1-2-6(12)8(3-5)15-10(17)9-7(13)4-14-16-9/h1-4H,13H2,(H,14,16)(H,15,17) |
| InChIKey | RBMFHJIDECEUON-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |