C11H10Cl2N4O — CID 63105942
4-amino-N-(2,6-dichloro-3-methylphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 63105942) has the molecular formula C11H10Cl2N4O and a molecular weight of 285.13 g/mol. Its IUPAC name is 4-amino-N-(2,6-dichloro-3-methylphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 4-amino-N-(2,6-dichloro-3-methylphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 63105942 |
| Molecular Formula | C11H10Cl2N4O |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 4-amino-N-(2,6-dichloro-3-methylphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | Cc1ccc(Cl)c(NC(=O)c2[nH]ncc2N)c1Cl |
| InChI | InChI=1S/C11H10Cl2N4O/c1-5-2-3-6(12)9(8(5)13)16-11(18)10-7(14)4-15-17-10/h2-4H,14H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | WZPFFLFOYYKYNN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |