C17H18N2O5S2 — CID 119354635
1-[3-(thiophen-2-ylmethylsulfamoyl)benzoyl]pyrrolidine-3-carboxylic acid (PubChem CID 119354635) has the molecular formula C17H18N2O5S2 and a molecular weight of 394.47 g/mol. Its IUPAC name is 1-[3-(thiophen-2-ylmethylsulfamoyl)benzoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[3-(thiophen-2-ylmethylsulfamoyl)benzoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 119354635 |
| Molecular Formula | C17H18N2O5S2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 1-[3-(thiophen-2-ylmethylsulfamoyl)benzoyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)c2cccc(S(=O)(=O)NCc3cccs3)c2)C1 |
| InChI | InChI=1S/C17H18N2O5S2/c20-16(19-7-6-13(11-19)17(21)22)12-3-1-5-15(9-12)26(23,24)18-10-14-4-2-8-25-14/h1-5,8-9,13,18H,6-7,10-11H2,(H,21,22) |
| InChIKey | KBWZSPSQARDCII-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |