C20H19ClNO6- — CID 54698939
2-[(E)-2-carboxy-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethenyl]-6-methoxyphenolate (PubChem CID 54698939) has the molecular formula C20H19ClNO6- and a molecular weight of 404.83 g/mol. Its IUPAC name is 2-[(E)-2-carboxy-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethenyl]-6-methoxyphenolate.
| Compound Name | 2-[(E)-2-carboxy-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethenyl]-6-methoxyphenolate |
|---|---|
| PubChem CID | 54698939 |
| Molecular Formula | C20H19ClNO6- |
| Molecular Weight | 404.83 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 2-[(E)-2-carboxy-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethenyl]-6-methoxyphenolate |
| SMILES | COc1cccc(/C=C(/NC(=O)COc2cc(C)c(Cl)c(C)c2)C(=O)O)c1[O-] |
| InChI | InChI=1S/C20H20ClNO6/c1-11-7-14(8-12(2)18(11)21)28-10-17(23)22-15(20(25)26)9-13-5-4-6-16(27-3)19(13)24/h4-9,24H,10H2,1-3H3,(H,22,23)(H,25,26)/p-1/b15-9+ |
| InChIKey | FCZRUNNGKAWOAG-OQLLNIDSSA-M |
| XLogP | 2.66 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.83 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|