C24H28ClNO6 — CID 7139976
(E)-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoic acid (PubChem CID 7139976) has the molecular formula C24H28ClNO6 and a molecular weight of 461.94 g/mol. Its IUPAC name is (E)-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 7139976 |
| Molecular Formula | C24H28ClNO6 |
| Molecular Weight | 461.94 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | (E)-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-3-(3-ethoxy-4-propoxyphenyl)prop-2-enoic acid |
| SMILES | CCCOc1ccc(/C=C(/NC(=O)COc2cc(C)c(Cl)c(C)c2)C(=O)O)cc1OCC |
| InChI | InChI=1S/C24H28ClNO6/c1-5-9-31-20-8-7-17(13-21(20)30-6-2)12-19(24(28)29)26-22(27)14-32-18-10-15(3)23(25)16(4)11-18/h7-8,10-13H,5-6,9,14H2,1-4H3,(H,26,27)(H,28,29)/b19-12+ |
| InChIKey | YEANIPXJTBISML-XDHOZWIPSA-N |
| XLogP | 4.77 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.94 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|