C21H22ClNO4 — CID 7139904
(E)-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-3-(4-ethylphenyl)prop-2-enoic acid (PubChem CID 7139904) has the molecular formula C21H22ClNO4 and a molecular weight of 387.86 g/mol. Its IUPAC name is (E)-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-3-(4-ethylphenyl)prop-2-enoic acid.
| Compound Name | (E)-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-3-(4-ethylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 7139904 |
| Molecular Formula | C21H22ClNO4 |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | (E)-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-3-(4-ethylphenyl)prop-2-enoic acid |
| SMILES | CCc1ccc(/C=C(/NC(=O)COc2cc(C)c(Cl)c(C)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C21H22ClNO4/c1-4-15-5-7-16(8-6-15)11-18(21(25)26)23-19(24)12-27-17-9-13(2)20(22)14(3)10-17/h5-11H,4,12H2,1-3H3,(H,23,24)(H,25,26)/b18-11+ |
| InChIKey | XAFOXOKCFBDUQW-WOJGMQOQSA-N |
| XLogP | 4.14 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|