C19H16Cl3NO4 — CID 7139884
(E)-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-3-(2,6-dichlorophenyl)prop-2-enoic acid (PubChem CID 7139884) has the molecular formula C19H16Cl3NO4 and a molecular weight of 428.70 g/mol. Its IUPAC name is (E)-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-3-(2,6-dichlorophenyl)prop-2-enoic acid.
| Compound Name | (E)-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-3-(2,6-dichlorophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 7139884 |
| Molecular Formula | C19H16Cl3NO4 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | (E)-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]-3-(2,6-dichlorophenyl)prop-2-enoic acid |
| SMILES | Cc1cc(OCC(=O)N/C(=C/c2c(Cl)cccc2Cl)C(=O)O)cc(C)c1Cl |
| InChI | InChI=1S/C19H16Cl3NO4/c1-10-6-12(7-11(2)18(10)22)27-9-17(24)23-16(19(25)26)8-13-14(20)4-3-5-15(13)21/h3-8H,9H2,1-2H3,(H,23,24)(H,25,26)/b16-8+ |
| InChIKey | NKICVVXKOSMUAI-LZYBPNLTSA-N |
| XLogP | 4.88 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|