C21H21ClNO6- — CID 54698943
4-[(E)-2-carboxy-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethenyl]-2-ethoxyphenolate (PubChem CID 54698943) has the molecular formula C21H21ClNO6- and a molecular weight of 418.85 g/mol. Its IUPAC name is 4-[(E)-2-carboxy-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethenyl]-2-ethoxyphenolate.
| Compound Name | 4-[(E)-2-carboxy-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethenyl]-2-ethoxyphenolate |
|---|---|
| PubChem CID | 54698943 |
| Molecular Formula | C21H21ClNO6- |
| Molecular Weight | 418.85 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 4-[(E)-2-carboxy-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]ethenyl]-2-ethoxyphenolate |
| SMILES | CCOc1cc(/C=C(/NC(=O)COc2cc(C)c(Cl)c(C)c2)C(=O)O)ccc1[O-] |
| InChI | InChI=1S/C21H22ClNO6/c1-4-28-18-10-14(5-6-17(18)24)9-16(21(26)27)23-19(25)11-29-15-7-12(2)20(22)13(3)8-15/h5-10,24H,4,11H2,1-3H3,(H,23,25)(H,26,27)/p-1/b16-9+ |
| InChIKey | POMLWQKTDPHAST-CXUHLZMHSA-M |
| XLogP | 3.05 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.85 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|