C20H16Cl3N3O4 — CID 126229506
(Z)-N-carbamoyl-3-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enamide (PubChem CID 126229506) has the molecular formula C20H16Cl3N3O4 and a molecular weight of 468.72 g/mol. Its IUPAC name is (Z)-N-carbamoyl-3-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-carbamoyl-3-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 126229506 |
| Molecular Formula | C20H16Cl3N3O4 |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | (Z)-N-carbamoyl-3-[3-chloro-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-2-cyanoprop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)NC(N)=O)cc(Cl)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H16Cl3N3O4/c1-2-29-17-7-11(5-13(9-24)19(27)26-20(25)28)6-16(23)18(17)30-10-12-3-4-14(21)8-15(12)22/h3-8H,2,10H2,1H3,(H3,25,26,27,28)/b13-5- |
| InChIKey | FEFJXRBVKUUVLG-ACAGNQJTSA-N |
| XLogP | 4.73 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|