C21H25ClO5 — CID 20990035
3-chloro-5-ethoxy-4-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]benzoic acid (PubChem CID 20990035) has the molecular formula C21H25ClO5 and a molecular weight of 392.88 g/mol. Its IUPAC name is 3-chloro-5-ethoxy-4-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]benzoic acid.
| Compound Name | 3-chloro-5-ethoxy-4-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 20990035 |
| Molecular Formula | C21H25ClO5 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 3-chloro-5-ethoxy-4-[2-(5-methyl-2-propan-2-ylphenoxy)ethoxy]benzoic acid |
| SMILES | CCOc1cc(C(=O)O)cc(Cl)c1OCCOc1cc(C)ccc1C(C)C |
| InChI | InChI=1S/C21H25ClO5/c1-5-25-19-12-15(21(23)24)11-17(22)20(19)27-9-8-26-18-10-14(4)6-7-16(18)13(2)3/h6-7,10-13H,5,8-9H2,1-4H3,(H,23,24) |
| InChIKey | MMPPNKPAGHIVMU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|