C27H38O6 — CID 70198892
2-(5-methyl-2-propan-2-ylphenoxy)acetic acid;4-octoxybenzoic acid (PubChem CID 70198892) has the molecular formula C27H38O6 and a molecular weight of 458.60 g/mol. Its IUPAC name is 2-(5-methyl-2-propan-2-ylphenoxy)acetic acid;4-octoxybenzoic acid.
| Compound Name | 2-(5-methyl-2-propan-2-ylphenoxy)acetic acid;4-octoxybenzoic acid |
|---|---|
| PubChem CID | 70198892 |
| Molecular Formula | C27H38O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 2-(5-methyl-2-propan-2-ylphenoxy)acetic acid;4-octoxybenzoic acid |
| SMILES | CCCCCCCCOc1ccc(C(=O)O)cc1.Cc1ccc(C(C)C)c(OCC(=O)O)c1 |
| InChI | InChI=1S/C15H22O3.C12H16O3/c1-2-3-4-5-6-7-12-18-14-10-8-13(9-11-14)15(16)17;1-8(2)10-5-4-9(3)6-11(10)15-7-12(13)14/h8-11H,2-7,12H2,1H3,(H,16,17);4-6,8H,7H2,1-3H3,(H,13,14) |
| InChIKey | HCUFVSYVPWYHJF-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|