C21H25ClN2O4 — CID 9276291
3-chloro-N'-(2,4-dimethylbenzoyl)-5-ethoxy-4-propoxybenzohydrazide (PubChem CID 9276291) has the molecular formula C21H25ClN2O4 and a molecular weight of 404.89 g/mol. Its IUPAC name is 3-chloro-N'-(2,4-dimethylbenzoyl)-5-ethoxy-4-propoxybenzohydrazide.
| Compound Name | 3-chloro-N'-(2,4-dimethylbenzoyl)-5-ethoxy-4-propoxybenzohydrazide |
|---|---|
| PubChem CID | 9276291 |
| Molecular Formula | C21H25ClN2O4 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 3-chloro-N'-(2,4-dimethylbenzoyl)-5-ethoxy-4-propoxybenzohydrazide |
| SMILES | CCCOc1c(Cl)cc(C(=O)NNC(=O)c2ccc(C)cc2C)cc1OCC |
| InChI | InChI=1S/C21H25ClN2O4/c1-5-9-28-19-17(22)11-15(12-18(19)27-6-2)20(25)23-24-21(26)16-8-7-13(3)10-14(16)4/h7-8,10-12H,5-6,9H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | VRSMCIUICLENTO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|