C17H16O5 — CID 54854887
4-[2-(3,5-dimethylphenoxy)acetyl]oxybenzoic acid (PubChem CID 54854887) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is 4-[2-(3,5-dimethylphenoxy)acetyl]oxybenzoic acid.
| Compound Name | 4-[2-(3,5-dimethylphenoxy)acetyl]oxybenzoic acid |
|---|---|
| PubChem CID | 54854887 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 4-[2-(3,5-dimethylphenoxy)acetyl]oxybenzoic acid |
| SMILES | Cc1cc(C)cc(OCC(=O)Oc2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C17H16O5/c1-11-7-12(2)9-15(8-11)21-10-16(18)22-14-5-3-13(4-6-14)17(19)20/h3-9H,10H2,1-2H3,(H,19,20) |
| InChIKey | CPOXAZVYXPXYGY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|