C27H23BrN2O5 — CID 19217976
[4-[(E)-2-cyano-3-(2-methoxyethylamino)-3-oxoprop-1-enyl]phenyl] 2-(2-bromo-4-phenylphenoxy)acetate (PubChem CID 19217976) has the molecular formula C27H23BrN2O5 and a molecular weight of 535.39 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-(2-methoxyethylamino)-3-oxoprop-1-enyl]phenyl] 2-(2-bromo-4-phenylphenoxy)acetate.
| Compound Name | [4-[(E)-2-cyano-3-(2-methoxyethylamino)-3-oxoprop-1-enyl]phenyl] 2-(2-bromo-4-phenylphenoxy)acetate |
|---|---|
| PubChem CID | 19217976 |
| Molecular Formula | C27H23BrN2O5 |
| Molecular Weight | 535.39 g/mol |
| Exact Mass | 534.08 |
| IUPAC Name | [4-[(E)-2-cyano-3-(2-methoxyethylamino)-3-oxoprop-1-enyl]phenyl] 2-(2-bromo-4-phenylphenoxy)acetate |
| SMILES | COCCNC(=O)/C(C#N)=C/c1ccc(OC(=O)COc2ccc(-c3ccccc3)cc2Br)cc1 |
| InChI | InChI=1S/C27H23BrN2O5/c1-33-14-13-30-27(32)22(17-29)15-19-7-10-23(11-8-19)35-26(31)18-34-25-12-9-21(16-24(25)28)20-5-3-2-4-6-20/h2-12,15-16H,13-14,18H2,1H3,(H,30,32)/b22-15+ |
| InChIKey | ZLXUQZUSOKCSQU-PXLXIMEGSA-N |
| XLogP | 4.77 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|