C23H19N3O6 — CID 4164754
[4-[2-cyano-3-(2-methoxyethylamino)-3-oxoprop-1-enyl]phenyl] 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 4164754) has the molecular formula C23H19N3O6 and a molecular weight of 433.42 g/mol. Its IUPAC name is [4-[2-cyano-3-(2-methoxyethylamino)-3-oxoprop-1-enyl]phenyl] 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [4-[2-cyano-3-(2-methoxyethylamino)-3-oxoprop-1-enyl]phenyl] 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 4164754 |
| Molecular Formula | C23H19N3O6 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | [4-[2-cyano-3-(2-methoxyethylamino)-3-oxoprop-1-enyl]phenyl] 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | COCCNC(=O)C(C#N)=Cc1ccc(OC(=O)CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C23H19N3O6/c1-31-11-10-25-21(28)16(13-24)12-15-6-8-17(9-7-15)32-20(27)14-26-22(29)18-4-2-3-5-19(18)23(26)30/h2-9,12H,10-11,14H2,1H3,(H,25,28) |
| InChIKey | MHDFAGWBDLJXDY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 125.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|