C20H16Cl2N2O4 — CID 19211026
[4-[(E)-2-cyano-3-(2-methoxyethylamino)-3-oxoprop-1-enyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 19211026) has the molecular formula C20H16Cl2N2O4 and a molecular weight of 419.26 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-(2-methoxyethylamino)-3-oxoprop-1-enyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-[(E)-2-cyano-3-(2-methoxyethylamino)-3-oxoprop-1-enyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 19211026 |
| Molecular Formula | C20H16Cl2N2O4 |
| Molecular Weight | 419.26 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | [4-[(E)-2-cyano-3-(2-methoxyethylamino)-3-oxoprop-1-enyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | COCCNC(=O)/C(C#N)=C/c1ccc(OC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H16Cl2N2O4/c1-27-9-8-24-19(25)14(12-23)10-13-2-5-16(6-3-13)28-20(26)17-7-4-15(21)11-18(17)22/h2-7,10-11H,8-9H2,1H3,(H,24,25)/b14-10+ |
| InChIKey | YJZZGENLZWEIEA-GXDHUFHOSA-N |
| XLogP | 3.88 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.26 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|