C22H13F2I2NO — CID 126376426
(E)-2-(2-fluorophenyl)-3-[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]prop-2-enenitrile (PubChem CID 126376426) has the molecular formula C22H13F2I2NO and a molecular weight of 599.16 g/mol. Its IUPAC name is (E)-2-(2-fluorophenyl)-3-[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(2-fluorophenyl)-3-[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 126376426 |
| Molecular Formula | C22H13F2I2NO |
| Molecular Weight | 599.16 g/mol |
| Exact Mass | 598.91 |
| IUPAC Name | (E)-2-(2-fluorophenyl)-3-[4-[(2-fluorophenyl)methoxy]-3,5-diiodophenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cc(I)c(OCc2ccccc2F)c(I)c1)c1ccccc1F |
| InChI | InChI=1S/C22H13F2I2NO/c23-18-7-3-1-5-15(18)13-28-22-20(25)10-14(11-21(22)26)9-16(12-27)17-6-2-4-8-19(17)24/h1-11H,13H2/b16-9- |
| InChIKey | ONFYJSHRWNZEAA-SXGWCWSVSA-N |
| XLogP | 6.82 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.16 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|