C26H20Cl2N2O4 — CID 126078206
(Z)-3-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-2-(4-nitrophenyl)prop-2-enenitrile (PubChem CID 126078206) has the molecular formula C26H20Cl2N2O4 and a molecular weight of 495.36 g/mol. Its IUPAC name is (Z)-3-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-2-(4-nitrophenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-2-(4-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126078206 |
| Molecular Formula | C26H20Cl2N2O4 |
| Molecular Weight | 495.36 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | (Z)-3-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-2-(4-nitrophenyl)prop-2-enenitrile |
| SMILES | C=CCc1cc(/C=C(\C#N)c2ccc([N+](=O)[O-])cc2)cc(OC)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H20Cl2N2O4/c1-3-4-19-11-17(12-21(15-29)18-6-9-23(10-7-18)30(31)32)13-25(33-2)26(19)34-16-20-5-8-22(27)14-24(20)28/h3,5-14H,1,4,16H2,2H3/b21-12+ |
| InChIKey | SIWAHGIQOATJDZ-CIAFOILYSA-N |
| XLogP | 7.28 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.36 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|