C26H21ClN2O4 — CID 3933516
2-(2-chlorophenyl)-3-[3-methoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]prop-2-enenitrile (PubChem CID 3933516) has the molecular formula C26H21ClN2O4 and a molecular weight of 460.92 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-[3-methoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]prop-2-enenitrile.
| Compound Name | 2-(2-chlorophenyl)-3-[3-methoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3933516 |
| Molecular Formula | C26H21ClN2O4 |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 2-(2-chlorophenyl)-3-[3-methoxy-4-[(4-nitrophenyl)methoxy]-5-prop-2-enylphenyl]prop-2-enenitrile |
| SMILES | C=CCc1cc(C=C(C#N)c2ccccc2Cl)cc(OC)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H21ClN2O4/c1-3-6-20-13-19(14-21(16-28)23-7-4-5-8-24(23)27)15-25(32-2)26(20)33-17-18-9-11-22(12-10-18)29(30)31/h3-5,7-15H,1,6,17H2,2H3 |
| InChIKey | OIAIZGQGRUJMSG-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|