C23H15BrCl2N2O4 — CID 98098576
(E)-3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-(4-nitrophenyl)prop-2-enenitrile (PubChem CID 98098576) has the molecular formula C23H15BrCl2N2O4 and a molecular weight of 534.19 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-(4-nitrophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-(4-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 98098576 |
| Molecular Formula | C23H15BrCl2N2O4 |
| Molecular Weight | 534.19 g/mol |
| Exact Mass | 531.96 |
| IUPAC Name | (E)-3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-(4-nitrophenyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)c2ccc([N+](=O)[O-])cc2)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H15BrCl2N2O4/c1-31-22-10-14(8-17(12-27)15-3-6-19(7-4-15)28(29)30)9-20(24)23(22)32-13-16-2-5-18(25)11-21(16)26/h2-11H,13H2,1H3/b17-8- |
| InChIKey | BXIYLAFENDCJCL-IUXPMGMMSA-N |
| XLogP | 7.32 |
| TPSA | 85.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.19 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|