C21H22Cl2N2O3 — CID 7897981
2-(2,6-dichlorophenoxy)ethyl (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate (PubChem CID 7897981) has the molecular formula C21H22Cl2N2O3 and a molecular weight of 421.32 g/mol. Its IUPAC name is 2-(2,6-dichlorophenoxy)ethyl (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate.
| Compound Name | 2-(2,6-dichlorophenoxy)ethyl (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7897981 |
| Molecular Formula | C21H22Cl2N2O3 |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 2-(2,6-dichlorophenoxy)ethyl (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate |
| SMILES | CCCn1c(C)cc(/C=C(\C#N)C(=O)OCCOc2c(Cl)cccc2Cl)c1C |
| InChI | InChI=1S/C21H22Cl2N2O3/c1-4-8-25-14(2)11-16(15(25)3)12-17(13-24)21(26)28-10-9-27-20-18(22)6-5-7-19(20)23/h5-7,11-12H,4,8-10H2,1-3H3/b17-12+ |
| InChIKey | GYAZCGXPFFJPGX-SFQUDFHCSA-N |
| XLogP | 5.35 |
| TPSA | 64.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|