C21H23ClN4O3 — CID 55420796
[1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate (PubChem CID 55420796) has the molecular formula C21H23ClN4O3 and a molecular weight of 414.89 g/mol. Its IUPAC name is [1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate.
| Compound Name | [1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55420796 |
| Molecular Formula | C21H23ClN4O3 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | [1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] (E)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoate |
| SMILES | CCCn1c(C)cc(/C=C(\C#N)C(=O)OC(C)C(=O)Nc2cccnc2Cl)c1C |
| InChI | InChI=1S/C21H23ClN4O3/c1-5-9-26-13(2)10-16(14(26)3)11-17(12-23)21(28)29-15(4)20(27)25-18-7-6-8-24-19(18)22/h6-8,10-11,15H,5,9H2,1-4H3,(H,25,27)/b17-11+ |
| InChIKey | JXYYGZWTKVBFIE-GZTJUZNOSA-N |
| XLogP | 4.04 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|