C19H17NO4 — CID 19766912
3-cyano-4,4-bis(4-methoxyphenyl)but-3-enoic acid (PubChem CID 19766912) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is 3-cyano-4,4-bis(4-methoxyphenyl)but-3-enoic acid.
| Compound Name | 3-cyano-4,4-bis(4-methoxyphenyl)but-3-enoic acid |
|---|---|
| PubChem CID | 19766912 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 3-cyano-4,4-bis(4-methoxyphenyl)but-3-enoic acid |
| SMILES | COc1ccc(C(=C(C#N)CC(=O)O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H17NO4/c1-23-16-7-3-13(4-8-16)19(15(12-20)11-18(21)22)14-5-9-17(24-2)10-6-14/h3-10H,11H2,1-2H3,(H,21,22) |
| InChIKey | FOVREWVYCRIMMG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|