C23H25NO4 — CID 139692656
ethyl 4-cyano-5,5-bis(4-methoxyphenyl)-2-methylpent-4-enoate (PubChem CID 139692656) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is ethyl 4-cyano-5,5-bis(4-methoxyphenyl)-2-methylpent-4-enoate.
| Compound Name | ethyl 4-cyano-5,5-bis(4-methoxyphenyl)-2-methylpent-4-enoate |
|---|---|
| PubChem CID | 139692656 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | ethyl 4-cyano-5,5-bis(4-methoxyphenyl)-2-methylpent-4-enoate |
| SMILES | CCOC(=O)C(C)CC(C#N)=C(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H25NO4/c1-5-28-23(25)16(2)14-19(15-24)22(17-6-10-20(26-3)11-7-17)18-8-12-21(27-4)13-9-18/h6-13,16H,5,14H2,1-4H3 |
| InChIKey | CYTSIPPAVMRVJS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|