C34H48O6 — CID 70148227
2-ethylhexyl (E)-3-(4-methoxyphenyl)prop-2-enoate;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate (PubChem CID 70148227) has the molecular formula C34H48O6 and a molecular weight of 552.75 g/mol. Its IUPAC name is 2-ethylhexyl (E)-3-(4-methoxyphenyl)prop-2-enoate;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate.
| Compound Name | 2-ethylhexyl (E)-3-(4-methoxyphenyl)prop-2-enoate;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate |
|---|---|
| PubChem CID | 70148227 |
| Molecular Formula | C34H48O6 |
| Molecular Weight | 552.75 g/mol |
| Exact Mass | 552.35 |
| IUPAC Name | 2-ethylhexyl (E)-3-(4-methoxyphenyl)prop-2-enoate;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate |
| SMILES | CC1CC(OC(=O)c2ccccc2O)CC(C)(C)C1.CCCCC(CC)COC(=O)/C=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H26O3.C16H22O3/c1-4-6-7-15(5-2)14-21-18(19)13-10-16-8-11-17(20-3)12-9-16;1-11-8-12(10-16(2,3)9-11)19-15(18)13-6-4-5-7-14(13)17/h8-13,15H,4-7,14H2,1-3H3;4-7,11-12,17H,8-10H2,1-3H3/b13-10+; |
| InChIKey | DAPIFCPDJFROKU-RSGUCCNWSA-N |
| XLogP | 8.23 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.75 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|