C17H16O3 — CID 163942767
(E,4R)-4-hydroxy-5-(4-hydroxyphenyl)-1-phenylpent-1-en-3-one (PubChem CID 163942767) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is (E,4R)-4-hydroxy-5-(4-hydroxyphenyl)-1-phenylpent-1-en-3-one.
| Compound Name | (E,4R)-4-hydroxy-5-(4-hydroxyphenyl)-1-phenylpent-1-en-3-one |
|---|---|
| PubChem CID | 163942767 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (E,4R)-4-hydroxy-5-(4-hydroxyphenyl)-1-phenylpent-1-en-3-one |
| SMILES | O=C(/C=C/c1ccccc1)[C@H](O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C17H16O3/c18-15-9-6-14(7-10-15)12-17(20)16(19)11-8-13-4-2-1-3-5-13/h1-11,17-18,20H,12H2/b11-8+/t17-/m1/s1 |
| InChIKey | RSLJCTWMGAQFHG-VGMNTSGFSA-N |
| XLogP | 2.58 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|